C16H21N3O — CID 104898627
(R)-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanamine (PubChem CID 104898627) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (R)-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanamine.
| Compound Name | (R)-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanamine |
|---|---|
| PubChem CID | 104898627 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (R)-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanamine |
| SMILES | CC1CCC(c2noc([C@H](N)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C16H21N3O/c1-11-7-9-13(10-8-11)15-18-16(20-19-15)14(17)12-5-3-2-4-6-12/h2-6,11,13-14H,7-10,17H2,1H3/t11?,13?,14-/m1/s1 |
| InChIKey | GTRCEOFYMSKGBV-UXUKBGGZSA-N |
| XLogP | 3.41 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |