C17H21ClN2O — CID 65389372
5-[chloro(phenyl)methyl]-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole (PubChem CID 65389372) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 5-[chloro(phenyl)methyl]-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole.
| Compound Name | 5-[chloro(phenyl)methyl]-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65389372 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-[chloro(phenyl)methyl]-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole |
| SMILES | CC1(C)CCC(c2noc(C(Cl)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C17H21ClN2O/c1-17(2)10-8-13(9-11-17)15-19-16(21-20-15)14(18)12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3 |
| InChIKey | WJLUQPUWLPTTIT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|