C14H16ClN3OS — CID 103594663
5-[chloro(phenyl)methyl]-3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazole (PubChem CID 103594663) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 5-[chloro(phenyl)methyl]-3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-[chloro(phenyl)methyl]-3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103594663 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-[chloro(phenyl)methyl]-3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazole |
| SMILES | CN1CCSCC1c1noc(C(Cl)c2ccccc2)n1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-18-7-8-20-9-11(18)13-16-14(19-17-13)12(15)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3 |
| InChIKey | OSUAXVPXOQTLAO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|