C15H26N2O3 — CID 65390284
5-(diethoxymethyl)-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole (PubChem CID 65390284) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65390284 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 5-(diethoxymethyl)-3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(C2CCC(C)(C)CC2)no1 |
| InChI | InChI=1S/C15H26N2O3/c1-5-18-14(19-6-2)13-16-12(17-20-13)11-7-9-15(3,4)10-8-11/h11,14H,5-10H2,1-4H3 |
| InChIKey | ZCEYBDDFUAUCSV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|