C11H20N2O3 — CID 63771158
3-butan-2-yl-5-(diethoxymethyl)-1,2,4-oxadiazole (PubChem CID 63771158) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-butan-2-yl-5-(diethoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 3-butan-2-yl-5-(diethoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63771158 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-butan-2-yl-5-(diethoxymethyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(C(C)CC)no1 |
| InChI | InChI=1S/C11H20N2O3/c1-5-8(4)9-12-10(16-13-9)11(14-6-2)15-7-3/h8,11H,5-7H2,1-4H3 |
| InChIKey | BOMWQXIGWCGEOL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|