C10H18N2O2 — CID 63716697
3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)butan-2-ol (PubChem CID 63716697) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)butan-2-ol.
| Compound Name | 3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 63716697 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)butan-2-ol |
| SMILES | CCC(C)c1noc(C(C)C(C)O)n1 |
| InChI | InChI=1S/C10H18N2O2/c1-5-6(2)9-11-10(14-12-9)7(3)8(4)13/h6-8,13H,5H2,1-4H3 |
| InChIKey | LKPYXQBFUVHLGR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |