C10H18N2O4 — CID 79605448
5-(diethoxymethyl)-3-(1-methoxyethyl)-1,2,4-oxadiazole (PubChem CID 79605448) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(1-methoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(1-methoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 79605448 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5-(diethoxymethyl)-3-(1-methoxyethyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(C(C)OC)no1 |
| InChI | InChI=1S/C10H18N2O4/c1-5-14-10(15-6-2)9-11-8(12-16-9)7(3)13-4/h7,10H,5-6H2,1-4H3 |
| InChIKey | VUAGFHTVSPIFFZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|