C8H15N3O3 — CID 79617105
3-(1-methoxyethyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine (PubChem CID 79617105) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(1-methoxyethyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(1-methoxyethyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 79617105 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-(1-methoxyethyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COCCNc1nc(C(C)OC)no1 |
| InChI | InChI=1S/C8H15N3O3/c1-6(13-3)7-10-8(14-11-7)9-4-5-12-2/h6H,4-5H2,1-3H3,(H,9,10,11) |
| InChIKey | QSDMLLAGXOGJDT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|