C8H15N3O2 — CID 116730899
N-ethyl-3-(1-methoxypropyl)-1,2,4-oxadiazol-5-amine (PubChem CID 116730899) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is N-ethyl-3-(1-methoxypropyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-ethyl-3-(1-methoxypropyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 116730899 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-ethyl-3-(1-methoxypropyl)-1,2,4-oxadiazol-5-amine |
| SMILES | CCNc1nc(C(CC)OC)no1 |
| InChI | InChI=1S/C8H15N3O2/c1-4-6(12-3)7-10-8(9-5-2)13-11-7/h6H,4-5H2,1-3H3,(H,9,10,11) |
| InChIKey | MBEGXWLXAUWLSS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |