C9H17N3O2 — CID 63717997
3-butan-2-yl-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine (PubChem CID 63717997) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-butan-2-yl-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-butan-2-yl-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 63717997 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-butan-2-yl-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine |
| SMILES | CCC(C)c1noc(NCCOC)n1 |
| InChI | InChI=1S/C9H17N3O2/c1-4-7(2)8-11-9(14-12-8)10-5-6-13-3/h7H,4-6H2,1-3H3,(H,10,11,12) |
| InChIKey | SOOGFWKMFHFEIE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|