About 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one
2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one (PubChem CID 64533837) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one.
Molecular Properties
| Compound Name | 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one |
| PubChem CID | 64533837 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one |
| SMILES | CCOC(C)c1noc(C(C)C(=O)CC)n1 |
| InChI | InChI=1S/C11H18N2O3/c1-5-9(14)7(3)11-12-10(13-16-11)8(4)15-6-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | BWLXGFVNHARPAW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one?
The IUPAC name of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one (CID 64533837) is 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one.
What is the SMILES notation for 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one?
The canonical SMILES for 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one is CCOC(C)c1noc(C(C)C(=O)CC)n1.
What is the InChIKey of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one?
The InChIKey is BWLXGFVNHARPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-5-9(14)7(3)11-12-10(13-16-11)8(4)15-6-2/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one?
2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one has a molecular weight of 226.28 g/mol, XLogP of 2.25, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-3-one is sourced from PubChem (CID 64533837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).