C9H16N2O3 — CID 63772870
5-(diethoxymethyl)-3-ethyl-1,2,4-oxadiazole (PubChem CID 63772870) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63772870 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 5-(diethoxymethyl)-3-ethyl-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(CC)no1 |
| InChI | InChI=1S/C9H16N2O3/c1-4-7-10-8(14-11-7)9(12-5-2)13-6-3/h9H,4-6H2,1-3H3 |
| InChIKey | JVTXSQAOCTZWRU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|