C7H12N2O3S — CID 131201821
3-ethyl-5-(1-methylsulfonylethyl)-1,2,4-oxadiazole (PubChem CID 131201821) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-ethyl-5-(1-methylsulfonylethyl)-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-(1-methylsulfonylethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131201821 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 3-ethyl-5-(1-methylsulfonylethyl)-1,2,4-oxadiazole |
| SMILES | CCc1noc(C(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C7H12N2O3S/c1-4-6-8-7(12-9-6)5(2)13(3,10)11/h5H,4H2,1-3H3 |
| InChIKey | UPDHXKDZPLDNBC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |