C9H14N2O3 — CID 162468885
methyl 3-(3-ethyl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 162468885) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 3-(3-ethyl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | methyl 3-(3-ethyl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 162468885 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | methyl 3-(3-ethyl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | CCc1noc(C(C)CC(=O)OC)n1 |
| InChI | InChI=1S/C9H14N2O3/c1-4-7-10-9(14-11-7)6(2)5-8(12)13-3/h6H,4-5H2,1-3H3 |
| InChIKey | CESMNCNMKUZIBJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |