About methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate
methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate (PubChem CID 126844077) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate.
Molecular Properties
| Compound Name | methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate |
| PubChem CID | 126844077 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate |
| SMILES | COC(=O)CC(C)c1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C12H19NO3/c1-8(6-11(14)15-5)9-7-10(16-13-9)12(2,3)4/h7-8H,6H2,1-5H3 |
| InChIKey | HMLALVANQIKRGO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate?
The IUPAC name of methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate (CID 126844077) is methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate.
What is the SMILES notation for methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate?
The canonical SMILES for methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate is COC(=O)CC(C)c1cc(C(C)(C)C)on1.
What is the InChIKey of methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate?
The InChIKey is HMLALVANQIKRGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-8(6-11(14)15-5)9-7-10(16-13-9)12(2,3)4/h7-8H,6H2,1-5H3.
What are the key properties of methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate?
methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate has a molecular weight of 225.29 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-tert-butyl-1,2-oxazol-3-yl)butanoate is sourced from PubChem (CID 126844077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).