About methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate
methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate (PubChem CID 103952281) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate.
Analyze methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
The IUPAC name of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate (CID 103952281) is methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate.
What is the SMILES notation for methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
The canonical SMILES for methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate is COC(=O)CC(C)NCCc1noc(C)n1.
What is the InChIKey of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
The InChIKey is CFIYCHGSULWKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-7(6-10(14)15-3)11-5-4-9-12-8(2)16-13-9/h7,11H,4-6H2,1-3H3.
What are the key properties of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate has a molecular weight of 227.26 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate is sourced from PubChem (CID 103952281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).