methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate

C10H17N3O3 — CID 103952281

IUPACmethyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate
SMILESCOC(=O)CC(C)NCCc1noc(C)n1
InChIInChI=1S/C10H17N3O3/c1-7(6-10(14)15-3)11-5-4-9-12-8(2)16-13-9/h7,11H,4-6H2,1-3H3
InChIKeyCFIYCHGSULWKHJ-UHFFFAOYSA-N
MW227.26 g/mol
LogP0.46
Rot. Bonds6

About methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate

methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate (PubChem CID 103952281) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate.

Molecular Properties

Compound Namemethyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate
PubChem CID103952281
Molecular FormulaC10H17N3O3
Molecular Weight227.26 g/mol
Exact Mass227.13
IUPAC Namemethyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate
SMILESCOC(=O)CC(C)NCCc1noc(C)n1
InChIInChI=1S/C10H17N3O3/c1-7(6-10(14)15-3)11-5-4-9-12-8(2)16-13-9/h7,11H,4-6H2,1-3H3
InChIKeyCFIYCHGSULWKHJ-UHFFFAOYSA-N
XLogP0.46
TPSA77.25 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 50.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
The IUPAC name of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate (CID 103952281) is methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate.
What is the SMILES notation for methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
The canonical SMILES for methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate is COC(=O)CC(C)NCCc1noc(C)n1.
What is the InChIKey of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
The InChIKey is CFIYCHGSULWKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-7(6-10(14)15-3)11-5-4-9-12-8(2)16-13-9/h7,11H,4-6H2,1-3H3.
What are the key properties of methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate?
methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate has a molecular weight of 227.26 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]butanoate is sourced from PubChem (CID 103952281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).