C9H14BrN3O3 — CID 106419608
methyl 2-bromo-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]propanoate (PubChem CID 106419608) has the molecular formula C9H14BrN3O3 and a molecular weight of 292.13 g/mol. Its IUPAC name is methyl 2-bromo-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 106419608 |
| Molecular Formula | C9H14BrN3O3 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | methyl 2-bromo-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]propanoate |
| SMILES | COC(=O)C(Br)CNCCc1noc(C)n1 |
| InChI | InChI=1S/C9H14BrN3O3/c1-6-12-8(13-16-6)3-4-11-5-7(10)9(14)15-2/h7,11H,3-5H2,1-2H3 |
| InChIKey | KTLLVDYXVVYITK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|