C7H12N4O3 — CID 107911873
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]ethyl carbamate (PubChem CID 107911873) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]ethyl carbamate.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 107911873 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]ethyl carbamate |
| SMILES | Cc1nc(CNCCOC(N)=O)no1 |
| InChI | InChI=1S/C7H12N4O3/c1-5-10-6(11-14-5)4-9-2-3-13-7(8)12/h9H,2-4H2,1H3,(H2,8,12) |
| InChIKey | USGJEDLMHSNACE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|