C8H15N3O2 — CID 107911665
4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]butan-2-ol (PubChem CID 107911665) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]butan-2-ol.
| Compound Name | 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 107911665 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]butan-2-ol |
| SMILES | Cc1nc(CNCCC(C)O)no1 |
| InChI | InChI=1S/C8H15N3O2/c1-6(12)3-4-9-5-8-10-7(2)13-11-8/h6,9,12H,3-5H2,1-2H3 |
| InChIKey | DSKHQNHZTLBFMV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|