C7H10ClN3O2 — CID 103881620
2-chloro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide (PubChem CID 103881620) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide.
| Compound Name | 2-chloro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 103881620 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-chloro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide |
| SMILES | Cc1nc(CNC(=O)C(C)Cl)no1 |
| InChI | InChI=1S/C7H10ClN3O2/c1-4(8)7(12)9-3-6-10-5(2)13-11-6/h4H,3H2,1-2H3,(H,9,12) |
| InChIKey | PECLCLOHLWOCGY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|