C7H9N3O3 — CID 130667873
N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-oxopropanamide (PubChem CID 130667873) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-oxopropanamide.
| Compound Name | N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 130667873 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-oxopropanamide |
| SMILES | CC(=O)C(=O)NCc1noc(C)n1 |
| InChI | InChI=1S/C7H9N3O3/c1-4(11)7(12)8-3-6-9-5(2)13-10-6/h3H2,1-2H3,(H,8,12) |
| InChIKey | ZRDGEJKDWUPAEQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|