C14H17FN2O3 — CID 63771999
5-(diethoxymethyl)-3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole (PubChem CID 63771999) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63771999 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-(diethoxymethyl)-3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(Cc2cccc(F)c2)no1 |
| InChI | InChI=1S/C14H17FN2O3/c1-3-18-14(19-4-2)13-16-12(17-20-13)9-10-6-5-7-11(15)8-10/h5-8,14H,3-4,9H2,1-2H3 |
| InChIKey | BGUVJROMBBSJKC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|