C12H17N3O3S — CID 63771839
5-(diethoxymethyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazole (PubChem CID 63771839) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63771839 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-(diethoxymethyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(Cc2nc(C)cs2)no1 |
| InChI | InChI=1S/C12H17N3O3S/c1-4-16-12(17-5-2)11-14-9(15-18-11)6-10-13-8(3)7-19-10/h7,12H,4-6H2,1-3H3 |
| InChIKey | HECVRKMVNGHIOH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|