C11H18F2N2O4 — CID 103150936
5-(diethoxymethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole (PubChem CID 103150936) has the molecular formula C11H18F2N2O4 and a molecular weight of 280.27 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103150936 |
| Molecular Formula | C11H18F2N2O4 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-(diethoxymethyl)-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(CCOCC(F)F)no1 |
| InChI | InChI=1S/C11H18F2N2O4/c1-3-17-11(18-4-2)10-14-9(15-19-10)5-6-16-7-8(12)13/h8,11H,3-7H2,1-2H3 |
| InChIKey | WYDOQCDTKMGEPS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|