C13H14ClF2N3O2 — CID 107315682
(R)-(2-chlorophenyl)-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 107315682) has the molecular formula C13H14ClF2N3O2 and a molecular weight of 317.72 g/mol. Its IUPAC name is (R)-(2-chlorophenyl)-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | (R)-(2-chlorophenyl)-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 107315682 |
| Molecular Formula | C13H14ClF2N3O2 |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (R)-(2-chlorophenyl)-[3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | N[C@@H](c1nc(CCOCC(F)F)no1)c1ccccc1Cl |
| InChI | InChI=1S/C13H14ClF2N3O2/c14-9-4-2-1-3-8(9)12(17)13-18-11(19-21-13)5-6-20-7-10(15)16/h1-4,10,12H,5-7,17H2/t12-/m1/s1 |
| InChIKey | UYLGLAJUUATFQI-GFCCVEGCSA-N |
| XLogP | 2.60 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|