C11H20N2O4 — CID 55243254
5-(diethoxymethyl)-3-(propoxymethyl)-1,2,4-oxadiazole (PubChem CID 55243254) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(propoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(propoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55243254 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 5-(diethoxymethyl)-3-(propoxymethyl)-1,2,4-oxadiazole |
| SMILES | CCCOCc1noc(C(OCC)OCC)n1 |
| InChI | InChI=1S/C11H20N2O4/c1-4-7-14-8-9-12-10(17-13-9)11(15-5-2)16-6-3/h11H,4-8H2,1-3H3 |
| InChIKey | NQTYFSFFSNWMEW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|