C12H20N2O3S — CID 80638291
5-(diethoxymethyl)-3-(thian-2-yl)-1,2,4-oxadiazole (PubChem CID 80638291) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(thian-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(thian-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 80638291 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-(diethoxymethyl)-3-(thian-2-yl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(C2CCCCS2)no1 |
| InChI | InChI=1S/C12H20N2O3S/c1-3-15-12(16-4-2)11-13-10(14-17-11)9-7-5-6-8-18-9/h9,12H,3-8H2,1-2H3 |
| InChIKey | KQNLRIBIDSLDBR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|