C8H11ClN2OS — CID 80620869
5-(1-chloroethyl)-3-(thiolan-2-yl)-1,2,4-oxadiazole (PubChem CID 80620869) has the molecular formula C8H11ClN2OS and a molecular weight of 218.71 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-(thiolan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-chloroethyl)-3-(thiolan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 80620869 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 5-(1-chloroethyl)-3-(thiolan-2-yl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1nc(C2CCCS2)no1 |
| InChI | InChI=1S/C8H11ClN2OS/c1-5(9)8-10-7(11-12-8)6-3-2-4-13-6/h5-6H,2-4H2,1H3 |
| InChIKey | FQXIPTFQRPEGCU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|