C14H17N3OS — CID 80620615
2-phenyl-2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 80620615) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-phenyl-2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | 2-phenyl-2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 80620615 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-phenyl-2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | NCC(c1ccccc1)c1nc(C2CCCS2)no1 |
| InChI | InChI=1S/C14H17N3OS/c15-9-11(10-5-2-1-3-6-10)14-16-13(17-18-14)12-7-4-8-19-12/h1-3,5-6,11-12H,4,7-9,15H2 |
| InChIKey | IOLOXROWFOJQME-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |