C10H12N4O — CID 65416623
5-(2-amino-1-phenylethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65416623) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-(2-amino-1-phenylethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-amino-1-phenylethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 65416623 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-(2-amino-1-phenylethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | NCC(c1ccccc1)c1nc(N)no1 |
| InChI | InChI=1S/C10H12N4O/c11-6-8(7-4-2-1-3-5-7)9-13-10(12)14-15-9/h1-5,8H,6,11H2,(H2,12,14) |
| InChIKey | MGOXVMMNVVERJR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |