C7H11N3OS — CID 80620872
[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 80620872) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is [3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 80620872 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | [3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | NCc1nc(C2CCCS2)no1 |
| InChI | InChI=1S/C7H11N3OS/c8-4-6-9-7(10-11-6)5-2-1-3-12-5/h5H,1-4,8H2 |
| InChIKey | ZSNODISBNBTMRA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |