About 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde
2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde (PubChem CID 115080477) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde |
| PubChem CID | 115080477 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1nc(C2CCCS2)no1 |
| InChI | InChI=1S/C8H10N2O2S/c11-4-3-7-9-8(10-12-7)6-2-1-5-13-6/h4,6H,1-3,5H2 |
| InChIKey | ZZQPKZMSPOLMDF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde?
The IUPAC name of 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde (CID 115080477) is 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde.
What is the SMILES notation for 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde?
The canonical SMILES for 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde is O=CCc1nc(C2CCCS2)no1.
What is the InChIKey of 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde?
The InChIKey is ZZQPKZMSPOLMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c11-4-3-7-9-8(10-12-7)6-2-1-5-13-6/h4,6H,1-3,5H2.
What are the key properties of 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde?
2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde has a molecular weight of 198.25 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]acetaldehyde is sourced from PubChem (CID 115080477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).