C9H14N2O2S — CID 80637584
(1S)-1-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 80637584) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (1S)-1-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (1S)-1-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 80637584 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1S)-1-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | C[C@H](O)c1nc(C2CCCCS2)no1 |
| InChI | InChI=1S/C9H14N2O2S/c1-6(12)9-10-8(11-13-9)7-4-2-3-5-14-7/h6-7,12H,2-5H2,1H3/t6-,7?/m0/s1 |
| InChIKey | SJLPFSKXKBSPDA-PKPIPKONSA-N |
| XLogP | 2.08 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |