C13H20N2O3S — CID 80620640
ethyl 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]butanoate (PubChem CID 80620640) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is ethyl 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]butanoate.
| Compound Name | ethyl 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 80620640 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | ethyl 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]butanoate |
| SMILES | CCOC(=O)C(CC)c1nc(C2CCCCS2)no1 |
| InChI | InChI=1S/C13H20N2O3S/c1-3-9(13(16)17-4-2)12-14-11(15-18-12)10-7-5-6-8-19-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | JYAYNVUBDDDWGQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |