C18H27BFN3O3 — CID 171114077
7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-methylspiro[6H-pyrano[3,2-c]pyrazole-5,4'-piperidine] (PubChem CID 171114077) has the molecular formula C18H27BFN3O3 and a molecular weight of 363.24 g/mol. Its IUPAC name is 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-methylspiro[6H-pyrano[3,2-c]pyrazole-5,4'-piperidine].
| Compound Name | 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-methylspiro[6H-pyrano[3,2-c]pyrazole-5,4'-piperidine] |
|---|---|
| PubChem CID | 171114077 |
| Molecular Formula | C18H27BFN3O3 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 7-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-methylspiro[6H-pyrano[3,2-c]pyrazole-5,4'-piperidine] |
| SMILES | Cn1cc2c(n1)C(=C(F)B1OC(C)(C)C(C)(C)O1)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C18H27BFN3O3/c1-16(2)17(3,4)26-19(25-16)15(20)12-10-18(6-8-21-9-7-18)24-13-11-23(5)22-14(12)13/h11,21H,6-10H2,1-5H3 |
| InChIKey | HZTYEWUBNCQWIM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|