C14H18NO2+ — CID 7219629
1'-methylspiro[3H-chromene-2,4'-piperidin-1-ium]-4-one (PubChem CID 7219629) has the molecular formula C14H18NO2+ and a molecular weight of 232.30 g/mol. Its IUPAC name is 1'-methylspiro[3H-chromene-2,4'-piperidin-1-ium]-4-one.
| Compound Name | 1'-methylspiro[3H-chromene-2,4'-piperidin-1-ium]-4-one |
|---|---|
| PubChem CID | 7219629 |
| Molecular Formula | C14H18NO2+ |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1'-methylspiro[3H-chromene-2,4'-piperidin-1-ium]-4-one |
| SMILES | C[NH+]1CCC2(CC1)CC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H17NO2/c1-15-8-6-14(7-9-15)10-12(16)11-4-2-3-5-13(11)17-14/h2-5H,6-10H2,1H3/p+1 |
| InChIKey | DCENWWFAIVPRAC-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |