C20H21NO4S — CID 7260663
1'-(4-methylphenyl)sulfonylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 7260663) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1'-(4-methylphenyl)sulfonylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-(4-methylphenyl)sulfonylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 7260663 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1'-(4-methylphenyl)sulfonylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(CC2)CC(=O)c2ccccc2O3)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-15-6-8-16(9-7-15)26(23,24)21-12-10-20(11-13-21)14-18(22)17-4-2-3-5-19(17)25-20/h2-9H,10-14H2,1H3 |
| InChIKey | KDRJYIRPRREXNO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |