C20H21NO5S — CID 90586016
1'-(2-ethoxyphenyl)sulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 90586016) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 1'-(2-ethoxyphenyl)sulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 1'-(2-ethoxyphenyl)sulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 90586016 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1'-(2-ethoxyphenyl)sulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | CCOc1ccccc1S(=O)(=O)N1CCC2(CC(=O)c3ccccc3O2)C1 |
| InChI | InChI=1S/C20H21NO5S/c1-2-25-18-9-5-6-10-19(18)27(23,24)21-12-11-20(14-21)13-16(22)15-7-3-4-8-17(15)26-20/h3-10H,2,11-14H2,1H3 |
| InChIKey | PPBNQCJJWOAQAK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |