C22H19NO4S — CID 90586030
1'-naphthalen-2-ylsulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 90586030) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is 1'-naphthalen-2-ylsulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 1'-naphthalen-2-ylsulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 90586030 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1'-naphthalen-2-ylsulfonylspiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | O=C1CC2(CCN(S(=O)(=O)c3ccc4ccccc4c3)C2)Oc2ccccc21 |
| InChI | InChI=1S/C22H19NO4S/c24-20-14-22(27-21-8-4-3-7-19(20)21)11-12-23(15-22)28(25,26)18-10-9-16-5-1-2-6-17(16)13-18/h1-10,13H,11-12,14-15H2 |
| InChIKey | LXHSMADADZIWSX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |