C13H15NO2 — CID 126751052
5-tert-butyl-7-methyl-1H-indole-2,3-dione (PubChem CID 126751052) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-tert-butyl-7-methyl-1H-indole-2,3-dione.
| Compound Name | 5-tert-butyl-7-methyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 126751052 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 5-tert-butyl-7-methyl-1H-indole-2,3-dione |
| SMILES | Cc1cc(C(C)(C)C)cc2c1NC(=O)C2=O |
| InChI | InChI=1S/C13H15NO2/c1-7-5-8(13(2,3)4)6-9-10(7)14-12(16)11(9)15/h5-6H,1-4H3,(H,14,15,16) |
| InChIKey | LKCKXWDHPIFICC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|