C9H3ClF3NO2 — CID 16793230
5-chloro-7-(trifluoromethyl)-1H-indole-2,3-dione (PubChem CID 16793230) has the molecular formula C9H3ClF3NO2 and a molecular weight of 249.57 g/mol. Its IUPAC name is 5-chloro-7-(trifluoromethyl)-1H-indole-2,3-dione.
| Compound Name | 5-chloro-7-(trifluoromethyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 16793230 |
| Molecular Formula | C9H3ClF3NO2 |
| Molecular Weight | 249.57 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 5-chloro-7-(trifluoromethyl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(cc(Cl)cc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C9H3ClF3NO2/c10-3-1-4-6(14-8(16)7(4)15)5(2-3)9(11,12)13/h1-2H,(H,14,15,16) |
| InChIKey | WBEGSXWHZFUWGE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|