C10H3F6NO2 — CID 2317893
4,7-bis(trifluoromethyl)isoindole-1,3-dione (PubChem CID 2317893) has the molecular formula C10H3F6NO2 and a molecular weight of 283.13 g/mol. Its IUPAC name is 4,7-bis(trifluoromethyl)isoindole-1,3-dione.
| Compound Name | 4,7-bis(trifluoromethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 2317893 |
| Molecular Formula | C10H3F6NO2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 4,7-bis(trifluoromethyl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(C(F)(F)F)ccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C10H3F6NO2/c11-9(12,13)3-1-2-4(10(14,15)16)6-5(3)7(18)17-8(6)19/h1-2H,(H,17,18,19) |
| InChIKey | YSUNXZLYKSZWIW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|