C8H2F3NO2 — CID 62811095
4,6,7-trifluoro-1H-indole-2,3-dione (PubChem CID 62811095) has the molecular formula C8H2F3NO2 and a molecular weight of 201.10 g/mol. Its IUPAC name is 4,6,7-trifluoro-1H-indole-2,3-dione.
| Compound Name | 4,6,7-trifluoro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 62811095 |
| Molecular Formula | C8H2F3NO2 |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 4,6,7-trifluoro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(F)c(F)cc(F)c2C1=O |
| InChI | InChI=1S/C8H2F3NO2/c9-2-1-3(10)5(11)6-4(2)7(13)8(14)12-6/h1H,(H,12,13,14) |
| InChIKey | WQLHXKSIQYHIRB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|