C14H6F3NO2 — CID 100960275
6,8,9-trifluoro-3-methylbenzo[g]isoquinoline-5,10-dione (PubChem CID 100960275) has the molecular formula C14H6F3NO2 and a molecular weight of 277.20 g/mol. Its IUPAC name is 6,8,9-trifluoro-3-methylbenzo[g]isoquinoline-5,10-dione.
| Compound Name | 6,8,9-trifluoro-3-methylbenzo[g]isoquinoline-5,10-dione |
|---|---|
| PubChem CID | 100960275 |
| Molecular Formula | C14H6F3NO2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 6,8,9-trifluoro-3-methylbenzo[g]isoquinoline-5,10-dione |
| SMILES | Cc1cc2c(cn1)C(=O)c1c(F)c(F)cc(F)c1C2=O |
| InChI | InChI=1S/C14H6F3NO2/c1-5-2-6-7(4-18-5)14(20)11-10(13(6)19)8(15)3-9(16)12(11)17/h2-4H,1H3 |
| InChIKey | INPUFUNDLPJWDZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|