C9H5BrFNO2 — CID 177167612
4-bromo-7-fluoro-6-methyl-1H-indole-2,3-dione (PubChem CID 177167612) has the molecular formula C9H5BrFNO2 and a molecular weight of 258.05 g/mol. Its IUPAC name is 4-bromo-7-fluoro-6-methyl-1H-indole-2,3-dione.
| Compound Name | 4-bromo-7-fluoro-6-methyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 177167612 |
| Molecular Formula | C9H5BrFNO2 |
| Molecular Weight | 258.05 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 4-bromo-7-fluoro-6-methyl-1H-indole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1F)NC(=O)C2=O |
| InChI | InChI=1S/C9H5BrFNO2/c1-3-2-4(10)5-7(6(3)11)12-9(14)8(5)13/h2H,1H3,(H,12,13,14) |
| InChIKey | OBZGCCRXZDOIEB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.05 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|