C10H7NO4 — CID 50850653
7-methyl-2,3-dioxo-1H-indole-4-carboxylic acid (PubChem CID 50850653) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 7-methyl-2,3-dioxo-1H-indole-4-carboxylic acid.
| Compound Name | 7-methyl-2,3-dioxo-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 50850653 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 7-methyl-2,3-dioxo-1H-indole-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c1NC(=O)C2=O |
| InChI | InChI=1S/C10H7NO4/c1-4-2-3-5(10(14)15)6-7(4)11-9(13)8(6)12/h2-3H,1H3,(H,14,15)(H,11,12,13) |
| InChIKey | JQSBQAMREVGHEB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|