C21H16O4 — CID 150641904
4-methyl-2-(4-phenylphenyl)benzene-1,3-dicarboxylic acid (PubChem CID 150641904) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-methyl-2-(4-phenylphenyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-methyl-2-(4-phenylphenyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150641904 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-methyl-2-(4-phenylphenyl)benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c(-c2ccc(-c3ccccc3)cc2)c1C(=O)O |
| InChI | InChI=1S/C21H16O4/c1-13-7-12-17(20(22)23)19(18(13)21(24)25)16-10-8-15(9-11-16)14-5-3-2-4-6-14/h2-12H,1H3,(H,22,23)(H,24,25) |
| InChIKey | JABXPFWRQLFLDP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |