C16H22O4 — CID 67877311
cyclohexane;2,4-dimethylbenzene-1,3-dicarboxylic acid (PubChem CID 67877311) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is cyclohexane;2,4-dimethylbenzene-1,3-dicarboxylic acid.
| Compound Name | cyclohexane;2,4-dimethylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 67877311 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | cyclohexane;2,4-dimethylbenzene-1,3-dicarboxylic acid |
| SMILES | C1CCCCC1.Cc1ccc(C(=O)O)c(C)c1C(=O)O |
| InChI | InChI=1S/C10H10O4.C6H12/c1-5-3-4-7(9(11)12)6(2)8(5)10(13)14;1-2-4-6-5-3-1/h3-4H,1-2H3,(H,11,12)(H,13,14);1-6H2 |
| InChIKey | CPXFJKQSQVLQEY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |