C12H12O3 — CID 131617703
1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid (PubChem CID 131617703) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid.
| Compound Name | 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid |
|---|---|
| PubChem CID | 131617703 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c1C(C)CC2=O |
| InChI | InChI=1S/C12H12O3/c1-6-3-4-8(12(14)15)11-9(13)5-7(2)10(6)11/h3-4,7H,5H2,1-2H3,(H,14,15) |
| InChIKey | LXQVMKKLQGLQMO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |