1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid

C12H12O3 — CID 131617703

IUPAC1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid
SMILESCc1ccc(C(=O)O)c2c1C(C)CC2=O
InChIInChI=1S/C12H12O3/c1-6-3-4-8(12(14)15)11-9(13)5-7(2)10(6)11/h3-4,7H,5H2,1-2H3,(H,14,15)
InChIKeyLXQVMKKLQGLQMO-UHFFFAOYSA-N
MW204.22 g/mol
LogP2.38
Rot. Bonds1

About 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid

1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid (PubChem CID 131617703) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid.

Molecular Properties

Compound Name1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid
PubChem CID131617703
Molecular FormulaC12H12O3
Molecular Weight204.22 g/mol
Exact Mass204.08
IUPAC Name1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid
SMILESCc1ccc(C(=O)O)c2c1C(C)CC2=O
InChIInChI=1S/C12H12O3/c1-6-3-4-8(12(14)15)11-9(13)5-7(2)10(6)11/h3-4,7H,5H2,1-2H3,(H,14,15)
InChIKeyLXQVMKKLQGLQMO-UHFFFAOYSA-N
XLogP2.38
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.22
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid?
The IUPAC name of 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid (CID 131617703) is 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid.
What is the SMILES notation for 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid?
The canonical SMILES for 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid is Cc1ccc(C(=O)O)c2c1C(C)CC2=O.
What is the InChIKey of 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid?
The InChIKey is LXQVMKKLQGLQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-6-3-4-8(12(14)15)11-9(13)5-7(2)10(6)11/h3-4,7H,5H2,1-2H3,(H,14,15).
What are the key properties of 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid?
1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid has a molecular weight of 204.22 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-3-oxo-1,2-dihydroindene-4-carboxylic acid is sourced from PubChem (CID 131617703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).