C22H20N2O4 — CID 18140189
(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate (PubChem CID 18140189) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18140189 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2=NN(c3ccccc3)C(=O)CC2)c2c1C(C)CC2=O |
| InChI | InChI=1S/C22H20N2O4/c1-13-8-10-18(21-17(25)12-14(2)20(13)21)28-22(27)16-9-11-19(26)24(23-16)15-6-4-3-5-7-15/h3-8,10,14H,9,11-12H2,1-2H3 |
| InChIKey | YRVDWDGQQJMMKA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|